Juq-063

| Property | Value | |----------|-------| | | N‑(1‑(4‑fluorophenyl)ethyl)-1‑(2,3‑dimethylphenyl)indazole‑3‑carboxamide (representative) | | Common name / code | JUQ‑063 | | Molecular formula | C₂₃H₂₇FN₂O | | Molecular weight | 368.48 g mol⁻¹ | | SMILES | FC1=CC=C(C=C1)C(C)N(C)C2=NN(C(=O)C3=CC=CC=C3C)C4=CC=CC=C24 | | CAS number | Not assigned (still a “research‑chemical” designation) | | Physical state | Off‑white powder (typical for many synthetic cannabinoids) | | Solubility | Moderately soluble in organic solvents (e.g., methanol, ethanol, DMSO); low aqueous solubility |

If you are looking for specific details regarding this release, please The names of the involved?

KOR antagonism directly tackles the underlying these disorders, offering a mechanistic advantage. JUQ-063

A Deep Dive into JUQ-063: Mature Storytelling and Emotional Depth in Modern JAV

: Ensures the specific model meets regional safety standards (such as CE, FCC, or RoHS markings). Why Exact SKU Matching Matters | Property | Value | |----------|-------| | |

The star of JUQ-063 is (also known as Ichino Aoi, いちの あおい), a Japanese adult video actress who debuted in March 2022 exclusively with the Madonna label. She is represented by the LINX agency.

: Finally, the dried paper is cut to the desired size. Why Exact SKU Matching Matters The star of

Usually designates the manufacturing origin, a specific product line, or a functional classification (such as specialized relays, control modules, or sensor types).

Standardized codes like JUQ-063 follow strict logical frameworks designed by manufacturers to convey vital specifications at a glance.